C9H13N3O2 — CID 83879292
3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)propanoic acid (PubChem CID 83879292) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)propanoic acid.
| Compound Name | 3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)propanoic acid |
|---|---|
| PubChem CID | 83879292 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)propanoic acid |
| SMILES | O=C(O)CCC1CCc2ncnn2C1 |
| InChI | InChI=1S/C9H13N3O2/c13-9(14)4-2-7-1-3-8-10-6-11-12(8)5-7/h6-7H,1-5H2,(H,13,14) |
| InChIKey | AJDMFWRWHQGEOH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |