About 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid
3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid (PubChem CID 83879776) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid.
Analyze 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid?
The IUPAC name of 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid (CID 83879776) is 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid.
What is the SMILES notation for 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid?
The canonical SMILES for 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid is O=C(O)CCC1CCCn2nnnc21.
What is the InChIKey of 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid?
The InChIKey is BEELONDEKJTJFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c13-7(14)4-3-6-2-1-5-12-8(6)9-10-11-12/h6H,1-5H2,(H,13,14).
What are the key properties of 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid?
3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid has a molecular weight of 196.21 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridin-8-yl)propanoic acid is sourced from PubChem (CID 83879776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).