About 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid
3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid (PubChem CID 83879786) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid |
| PubChem CID | 83879786 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid |
| SMILES | O=C(O)c1nc(N2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C8H12N4O2/c13-7(14)6-9-8(11-10-6)12-4-2-1-3-5-12/h1-5H2,(H,13,14)(H,9,10,11) |
| InChIKey | JZOPZTUFOVPNIO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid?
The IUPAC name of 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid (CID 83879786) is 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid.
What is the SMILES notation for 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid?
The canonical SMILES for 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid is O=C(O)c1nc(N2CCCCC2)n[nH]1.
What is the InChIKey of 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid?
The InChIKey is JZOPZTUFOVPNIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c13-7(14)6-9-8(11-10-6)12-4-2-1-3-5-12/h1-5H2,(H,13,14)(H,9,10,11).
What are the key properties of 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid?
3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid has a molecular weight of 196.21 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-yl-1H-1,2,4-triazole-5-carboxylic acid is sourced from PubChem (CID 83879786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).