About 4-bromopyrazolo[1,5-a]pyridine
4-bromopyrazolo[1,5-a]pyridine (PubChem CID 83880015) has the molecular formula C7H5BrN2
and a molecular weight of 197.04 g/mol. Its IUPAC name is 4-bromopyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 4-bromopyrazolo[1,5-a]pyridine |
| PubChem CID | 83880015 |
| Molecular Formula | C7H5BrN2 |
| Molecular Weight | 197.04 g/mol |
| Exact Mass | 195.96 |
| IUPAC Name | 4-bromopyrazolo[1,5-a]pyridine |
| SMILES | Brc1cccn2nccc12 |
| InChI | InChI=1S/C7H5BrN2/c8-6-2-1-5-10-7(6)3-4-9-10/h1-5H |
| InChIKey | CVKNKNVZHOMOHD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.04 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromopyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromopyrazolo[1,5-a]pyridine?
The IUPAC name of 4-bromopyrazolo[1,5-a]pyridine (CID 83880015) is 4-bromopyrazolo[1,5-a]pyridine.
What is the SMILES notation for 4-bromopyrazolo[1,5-a]pyridine?
The canonical SMILES for 4-bromopyrazolo[1,5-a]pyridine is Brc1cccn2nccc12.
What is the InChIKey of 4-bromopyrazolo[1,5-a]pyridine?
The InChIKey is CVKNKNVZHOMOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2/c8-6-2-1-5-10-7(6)3-4-9-10/h1-5H.
What are the key properties of 4-bromopyrazolo[1,5-a]pyridine?
4-bromopyrazolo[1,5-a]pyridine has a molecular weight of 197.04 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromopyrazolo[1,5-a]pyridine is sourced from PubChem (CID 83880015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).