C9H15N3O2 — CID 83880057
5-(1-amino-2-hydroxyethyl)-3-propan-2-ylpyrimidin-4-one (PubChem CID 83880057) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-(1-amino-2-hydroxyethyl)-3-propan-2-ylpyrimidin-4-one.
| Compound Name | 5-(1-amino-2-hydroxyethyl)-3-propan-2-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 83880057 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 5-(1-amino-2-hydroxyethyl)-3-propan-2-ylpyrimidin-4-one |
| SMILES | CC(C)n1cncc(C(N)CO)c1=O |
| InChI | InChI=1S/C9H15N3O2/c1-6(2)12-5-11-3-7(9(12)14)8(10)4-13/h3,5-6,8,13H,4,10H2,1-2H3 |
| InChIKey | WYKXSGMDPMDAGE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |