C12H14N2O — CID 83881219
9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-6-ol (PubChem CID 83881219) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-6-ol.
| Compound Name | 9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-6-ol |
|---|---|
| PubChem CID | 83881219 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-6-ol |
| SMILES | Cn1c2c(c3cc(O)ccc31)CCNC2 |
| InChI | InChI=1S/C12H14N2O/c1-14-11-3-2-8(15)6-10(11)9-4-5-13-7-12(9)14/h2-3,6,13,15H,4-5,7H2,1H3 |
| InChIKey | BWXCQRLVKYJFBM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|