About 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione
2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione (PubChem CID 83881828) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione.
Molecular Properties
| Compound Name | 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione |
| PubChem CID | 83881828 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione |
| SMILES | O=C1CCn2c(nc(C3CC3)cc2=O)C1 |
| InChI | InChI=1S/C11H12N2O2/c14-8-3-4-13-10(5-8)12-9(6-11(13)15)7-1-2-7/h6-7H,1-5H2 |
| InChIKey | AJBKXMLJJVSTIU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione?
The IUPAC name of 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione (CID 83881828) is 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione.
What is the SMILES notation for 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione?
The canonical SMILES for 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione is O=C1CCn2c(nc(C3CC3)cc2=O)C1.
What is the InChIKey of 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione?
The InChIKey is AJBKXMLJJVSTIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c14-8-3-4-13-10(5-8)12-9(6-11(13)15)7-1-2-7/h6-7H,1-5H2.
What are the key properties of 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione?
2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione has a molecular weight of 204.23 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-7,9-dihydro-6H-pyrido[1,2-a]pyrimidine-4,8-dione is sourced from PubChem (CID 83881828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).