About 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one
2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one (PubChem CID 83881992) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one.
Molecular Properties
| Compound Name | 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one |
| PubChem CID | 83881992 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one |
| SMILES | O=C1CCc2nc(C3CCCC3)cn2C1 |
| InChI | InChI=1S/C12H16N2O/c15-10-5-6-12-13-11(8-14(12)7-10)9-3-1-2-4-9/h8-9H,1-7H2 |
| InChIKey | PAEZLPDWOKOELC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one?
The IUPAC name of 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one (CID 83881992) is 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one.
What is the SMILES notation for 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one?
The canonical SMILES for 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one is O=C1CCc2nc(C3CCCC3)cn2C1.
What is the InChIKey of 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one?
The InChIKey is PAEZLPDWOKOELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c15-10-5-6-12-13-11(8-14(12)7-10)9-3-1-2-4-9/h8-9H,1-7H2.
What are the key properties of 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one?
2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one has a molecular weight of 204.27 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one is sourced from PubChem (CID 83881992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).