C10H11N3O2 — CID 83882340
4-(aminomethyl)-2-(4-hydroxyphenyl)-1H-pyrazol-3-one (PubChem CID 83882340) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 4-(aminomethyl)-2-(4-hydroxyphenyl)-1H-pyrazol-3-one.
| Compound Name | 4-(aminomethyl)-2-(4-hydroxyphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 83882340 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-(aminomethyl)-2-(4-hydroxyphenyl)-1H-pyrazol-3-one |
| SMILES | NCc1c[nH]n(-c2ccc(O)cc2)c1=O |
| InChI | InChI=1S/C10H11N3O2/c11-5-7-6-12-13(10(7)15)8-1-3-9(14)4-2-8/h1-4,6,12,14H,5,11H2 |
| InChIKey | VFTRBDYAEJJPPC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |