C10H11FN4 — CID 83882734
5-(3-fluorophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 83882734) has the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(3-fluorophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 83882734 |
| Molecular Formula | C10H11FN4 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 5-(3-fluorophenyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CNc1nnc(-c2cccc(F)c2)n1C |
| InChI | InChI=1S/C10H11FN4/c1-12-10-14-13-9(15(10)2)7-4-3-5-8(11)6-7/h3-6H,1-2H3,(H,12,14) |
| InChIKey | ATFSZISKBGUUIN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |