C11H17N3O — CID 83883349
3-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carbaldehyde (PubChem CID 83883349) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carbaldehyde.
| Compound Name | 3-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 83883349 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carbaldehyde |
| SMILES | CC(C)(C)c1nnc2n1C(C=O)CCC2 |
| InChI | InChI=1S/C11H17N3O/c1-11(2,3)10-13-12-9-6-4-5-8(7-15)14(9)10/h7-8H,4-6H2,1-3H3 |
| InChIKey | LAIPSBMNNDBZFI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|