About 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid
5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid (PubChem CID 83884852) has the molecular formula C8H6N2O3S
and a molecular weight of 210.21 g/mol. Its IUPAC name is 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid |
| PubChem CID | 83884852 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid |
| SMILES | Cn1cc(C(=O)O)c2scnc2c1=O |
| InChI | InChI=1S/C8H6N2O3S/c1-10-2-4(8(12)13)6-5(7(10)11)9-3-14-6/h2-3H,1H3,(H,12,13) |
| InChIKey | XHJJZHQYGPRMKT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid?
The IUPAC name of 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid (CID 83884852) is 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid.
What is the SMILES notation for 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid?
The canonical SMILES for 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid is Cn1cc(C(=O)O)c2scnc2c1=O.
What is the InChIKey of 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid?
The InChIKey is XHJJZHQYGPRMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3S/c1-10-2-4(8(12)13)6-5(7(10)11)9-3-14-6/h2-3H,1H3,(H,12,13).
What are the key properties of 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid?
5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid has a molecular weight of 210.21 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid is sourced from PubChem (CID 83884852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).