5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid

C8H6N2O3S — CID 83884852

IUPAC5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid
SMILESCn1cc(C(=O)O)c2scnc2c1=O
InChIInChI=1S/C8H6N2O3S/c1-10-2-4(8(12)13)6-5(7(10)11)9-3-14-6/h2-3H,1H3,(H,12,13)
InChIKeyXHJJZHQYGPRMKT-UHFFFAOYSA-N
MW210.21 g/mol
LogP0.69
Rot. Bonds1

About 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid

5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid (PubChem CID 83884852) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid.

Molecular Properties

Compound Name5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid
PubChem CID83884852
Molecular FormulaC8H6N2O3S
Molecular Weight210.21 g/mol
Exact Mass210.01
IUPAC Name5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid
SMILESCn1cc(C(=O)O)c2scnc2c1=O
InChIInChI=1S/C8H6N2O3S/c1-10-2-4(8(12)13)6-5(7(10)11)9-3-14-6/h2-3H,1H3,(H,12,13)
InChIKeyXHJJZHQYGPRMKT-UHFFFAOYSA-N
XLogP0.69
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.21
LogP ≤ 50.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid?
The IUPAC name of 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid (CID 83884852) is 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid.
What is the SMILES notation for 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid?
The canonical SMILES for 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid is Cn1cc(C(=O)O)c2scnc2c1=O.
What is the InChIKey of 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid?
The InChIKey is XHJJZHQYGPRMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3S/c1-10-2-4(8(12)13)6-5(7(10)11)9-3-14-6/h2-3H,1H3,(H,12,13).
What are the key properties of 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid?
5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid has a molecular weight of 210.21 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-oxo-[1,3]thiazolo[4,5-c]pyridine-7-carboxylic acid is sourced from PubChem (CID 83884852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).