C9H14N4O2 — CID 83884976
(3-methyl-1-nitro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)methanamine (PubChem CID 83884976) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is (3-methyl-1-nitro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)methanamine.
| Compound Name | (3-methyl-1-nitro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)methanamine |
|---|---|
| PubChem CID | 83884976 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (3-methyl-1-nitro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)methanamine |
| SMILES | Cc1nc([N+](=O)[O-])c2n1C(CN)CCC2 |
| InChI | InChI=1S/C9H14N4O2/c1-6-11-9(13(14)15)8-4-2-3-7(5-10)12(6)8/h7H,2-5,10H2,1H3 |
| InChIKey | LDFHNUFRYOJJOK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|