About 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one
2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one (PubChem CID 83885763) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one.
Molecular Properties
| Compound Name | 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one |
| PubChem CID | 83885763 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one |
| SMILES | O=C1CCc2nc(-c3ccccc3)cn2C1 |
| InChI | InChI=1S/C13H12N2O/c16-11-6-7-13-14-12(9-15(13)8-11)10-4-2-1-3-5-10/h1-5,9H,6-8H2 |
| InChIKey | GWKOLYATSVMQGZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one?
The IUPAC name of 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one (CID 83885763) is 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one.
What is the SMILES notation for 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one?
The canonical SMILES for 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one is O=C1CCc2nc(-c3ccccc3)cn2C1.
What is the InChIKey of 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one?
The InChIKey is GWKOLYATSVMQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c16-11-6-7-13-14-12(9-15(13)8-11)10-4-2-1-3-5-10/h1-5,9H,6-8H2.
What are the key properties of 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one?
2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one has a molecular weight of 212.25 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-7,8-dihydro-5H-imidazo[1,2-a]pyridin-6-one is sourced from PubChem (CID 83885763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).