About 6-bromo-4-fluoro-2,3-dihydro-1H-indole
6-bromo-4-fluoro-2,3-dihydro-1H-indole (PubChem CID 83886924) has the molecular formula C8H7BrFN
and a molecular weight of 216.05 g/mol. Its IUPAC name is 6-bromo-4-fluoro-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6-bromo-4-fluoro-2,3-dihydro-1H-indole |
| PubChem CID | 83886924 |
| Molecular Formula | C8H7BrFN |
| Molecular Weight | 216.05 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | 6-bromo-4-fluoro-2,3-dihydro-1H-indole |
| SMILES | Fc1cc(Br)cc2c1CCN2 |
| InChI | InChI=1S/C8H7BrFN/c9-5-3-7(10)6-1-2-11-8(6)4-5/h3-4,11H,1-2H2 |
| InChIKey | XCBCVNKQTAXXDA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.05 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-4-fluoro-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-fluoro-2,3-dihydro-1H-indole?
The IUPAC name of 6-bromo-4-fluoro-2,3-dihydro-1H-indole (CID 83886924) is 6-bromo-4-fluoro-2,3-dihydro-1H-indole.
What is the SMILES notation for 6-bromo-4-fluoro-2,3-dihydro-1H-indole?
The canonical SMILES for 6-bromo-4-fluoro-2,3-dihydro-1H-indole is Fc1cc(Br)cc2c1CCN2.
What is the InChIKey of 6-bromo-4-fluoro-2,3-dihydro-1H-indole?
The InChIKey is XCBCVNKQTAXXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrFN/c9-5-3-7(10)6-1-2-11-8(6)4-5/h3-4,11H,1-2H2.
What are the key properties of 6-bromo-4-fluoro-2,3-dihydro-1H-indole?
6-bromo-4-fluoro-2,3-dihydro-1H-indole has a molecular weight of 216.05 g/mol, XLogP of 2.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-fluoro-2,3-dihydro-1H-indole is sourced from PubChem (CID 83886924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).