About 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid
1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid (PubChem CID 83887340) has the molecular formula C8H9ClN2O3
and a molecular weight of 216.62 g/mol. Its IUPAC name is 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid.
Molecular Properties
| Compound Name | 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid |
| PubChem CID | 83887340 |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid |
| SMILES | O=C(O)C1(O)CCn2cnc(Cl)c2C1 |
| InChI | InChI=1S/C8H9ClN2O3/c9-6-5-3-8(14,7(12)13)1-2-11(5)4-10-6/h4,14H,1-3H2,(H,12,13) |
| InChIKey | AFZJGKOHYBYQDD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid?
The IUPAC name of 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid (CID 83887340) is 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid.
What is the SMILES notation for 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid?
The canonical SMILES for 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid is O=C(O)C1(O)CCn2cnc(Cl)c2C1.
What is the InChIKey of 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid?
The InChIKey is AFZJGKOHYBYQDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O3/c9-6-5-3-8(14,7(12)13)1-2-11(5)4-10-6/h4,14H,1-3H2,(H,12,13).
What are the key properties of 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid?
1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid has a molecular weight of 216.62 g/mol, XLogP of 0.30, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-7-hydroxy-6,8-dihydro-5H-imidazo[1,5-a]pyridine-7-carboxylic acid is sourced from PubChem (CID 83887340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).