About 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol
2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol (PubChem CID 83889487) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol |
| PubChem CID | 83889487 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol |
| SMILES | CC(C)c1nc2ncc(C(O)CN)cc2[nH]1 |
| InChI | InChI=1S/C11H16N4O/c1-6(2)10-14-8-3-7(9(16)4-12)5-13-11(8)15-10/h3,5-6,9,16H,4,12H2,1-2H3,(H,13,14,15) |
| InChIKey | VBUVNBBCMBNMMD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol?
The IUPAC name of 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol (CID 83889487) is 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol.
What is the SMILES notation for 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol?
The canonical SMILES for 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol is CC(C)c1nc2ncc(C(O)CN)cc2[nH]1.
What is the InChIKey of 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol?
The InChIKey is VBUVNBBCMBNMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-6(2)10-14-8-3-7(9(16)4-12)5-13-11(8)15-10/h3,5-6,9,16H,4,12H2,1-2H3,(H,13,14,15).
What are the key properties of 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol?
2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol has a molecular weight of 220.28 g/mol, XLogP of 1.07, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2-propan-2-yl-1H-imidazo[4,5-b]pyridin-6-yl)ethanol is sourced from PubChem (CID 83889487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).