About (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane
(12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane (PubChem CID 838902) has the molecular formula C14H24O2S2
and a molecular weight of 288.48 g/mol. Its IUPAC name is (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane.
Molecular Properties
| Compound Name | (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane |
| PubChem CID | 838902 |
| Molecular Formula | C14H24O2S2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane |
| SMILES | CC(C)(C)[C@@H]1CCC2(OCCO2)C2(C1)SCCS2 |
| InChI | InChI=1S/C14H24O2S2/c1-12(2,3)11-4-5-13(15-6-7-16-13)14(10-11)17-8-9-18-14/h11H,4-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | VXKKADBORMPSNU-LLVKDONJSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane?
The IUPAC name of (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane (CID 838902) is (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane.
What is the SMILES notation for (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane?
The canonical SMILES for (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane is CC(C)(C)[C@@H]1CCC2(OCCO2)C2(C1)SCCS2.
What is the InChIKey of (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane?
The InChIKey is VXKKADBORMPSNU-LLVKDONJSA-N. The full InChI is InChI=1S/C14H24O2S2/c1-12(2,3)11-4-5-13(15-6-7-16-13)14(10-11)17-8-9-18-14/h11H,4-10H2,1-3H3/t11-/m1/s1.
What are the key properties of (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane?
(12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane has a molecular weight of 288.48 g/mol, XLogP of 3.75, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (12R)-12-tert-butyl-1,4-dioxa-7,10-dithiadispiro[4.0.46.45]tetradecane is sourced from PubChem (CID 838902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).