About 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol
2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol (PubChem CID 83890433) has the molecular formula C9H10N4O3
and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol |
| PubChem CID | 83890433 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol |
| SMILES | NCC(O)c1ccn2cnc([N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C9H10N4O3/c10-4-8(14)6-1-2-12-5-11-9(13(15)16)7(12)3-6/h1-3,5,8,14H,4,10H2 |
| InChIKey | VVLYGRAPKDYHNS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol?
The IUPAC name of 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol (CID 83890433) is 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol.
What is the SMILES notation for 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol?
The canonical SMILES for 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol is NCC(O)c1ccn2cnc([N+](=O)[O-])c2c1.
What is the InChIKey of 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol?
The InChIKey is VVLYGRAPKDYHNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O3/c10-4-8(14)6-1-2-12-5-11-9(13(15)16)7(12)3-6/h1-3,5,8,14H,4,10H2.
What are the key properties of 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol?
2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol has a molecular weight of 222.20 g/mol, XLogP of 0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(1-nitroimidazo[1,5-a]pyridin-7-yl)ethanol is sourced from PubChem (CID 83890433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).