C11H18N4O — CID 83890793
2,3-dimethyl-5-(piperazin-1-ylmethyl)pyrimidin-4-one (PubChem CID 83890793) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 2,3-dimethyl-5-(piperazin-1-ylmethyl)pyrimidin-4-one.
| Compound Name | 2,3-dimethyl-5-(piperazin-1-ylmethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 83890793 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2,3-dimethyl-5-(piperazin-1-ylmethyl)pyrimidin-4-one |
| SMILES | Cc1ncc(CN2CCNCC2)c(=O)n1C |
| InChI | InChI=1S/C11H18N4O/c1-9-13-7-10(11(16)14(9)2)8-15-5-3-12-4-6-15/h7,12H,3-6,8H2,1-2H3 |
| InChIKey | NLWUAOUGLYMBBO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |