About 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine
1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine (PubChem CID 83890988) has the molecular formula C12H15ClN2
and a molecular weight of 222.72 g/mol. Its IUPAC name is 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine |
| PubChem CID | 83890988 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine |
| SMILES | CNCc1cc(Cl)c2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C12H15ClN2/c1-7-8(2)15-12-10(7)4-9(6-14-3)5-11(12)13/h4-5,14-15H,6H2,1-3H3 |
| InChIKey | WJDKWXMRMJHZAQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine?
The IUPAC name of 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine (CID 83890988) is 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine?
The canonical SMILES for 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine is CNCc1cc(Cl)c2[nH]c(C)c(C)c2c1.
What is the InChIKey of 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine?
The InChIKey is WJDKWXMRMJHZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2/c1-7-8(2)15-12-10(7)4-9(6-14-3)5-11(12)13/h4-5,14-15H,6H2,1-3H3.
What are the key properties of 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine?
1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine has a molecular weight of 222.72 g/mol, XLogP of 3.16, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-chloro-2,3-dimethyl-1H-indol-5-yl)-N-methylmethanamine is sourced from PubChem (CID 83890988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).