C10H14ClN3O — CID 83893060
2-chloro-7-(dimethylamino)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 83893060) has the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-chloro-7-(dimethylamino)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-chloro-7-(dimethylamino)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 83893060 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-chloro-7-(dimethylamino)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | CN(C)C1CCn2c(nc(Cl)c2C=O)C1 |
| InChI | InChI=1S/C10H14ClN3O/c1-13(2)7-3-4-14-8(6-15)10(11)12-9(14)5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | PSPRGEYLBJOLLD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|