About 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one
1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one (PubChem CID 83893540) has the molecular formula C8H9BrN2O
and a molecular weight of 229.08 g/mol. Its IUPAC name is 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one.
Molecular Properties
| Compound Name | 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one |
| PubChem CID | 83893540 |
| Molecular Formula | C8H9BrN2O |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one |
| SMILES | Cc1nc(Br)c2n1CCC(=O)C2 |
| InChI | InChI=1S/C8H9BrN2O/c1-5-10-8(9)7-4-6(12)2-3-11(5)7/h2-4H2,1H3 |
| InChIKey | NLGAYQXZWBJIAV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one?
The IUPAC name of 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one (CID 83893540) is 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one.
What is the SMILES notation for 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one?
The canonical SMILES for 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one is Cc1nc(Br)c2n1CCC(=O)C2.
What is the InChIKey of 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one?
The InChIKey is NLGAYQXZWBJIAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2O/c1-5-10-8(9)7-4-6(12)2-3-11(5)7/h2-4H2,1H3.
What are the key properties of 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one?
1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one has a molecular weight of 229.08 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyridin-7-one is sourced from PubChem (CID 83893540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).