C13H15N3O — CID 83893722
2-(5-amino-4,5,6,7-tetrahydroindazol-1-yl)phenol (PubChem CID 83893722) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(5-amino-4,5,6,7-tetrahydroindazol-1-yl)phenol.
| Compound Name | 2-(5-amino-4,5,6,7-tetrahydroindazol-1-yl)phenol |
|---|---|
| PubChem CID | 83893722 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-(5-amino-4,5,6,7-tetrahydroindazol-1-yl)phenol |
| SMILES | NC1CCc2c(cnn2-c2ccccc2O)C1 |
| InChI | InChI=1S/C13H15N3O/c14-10-5-6-11-9(7-10)8-15-16(11)12-3-1-2-4-13(12)17/h1-4,8,10,17H,5-7,14H2 |
| InChIKey | CGIZRPKIXPKUNA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |