C9H10F3N3O — CID 83895446
3-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 83895446) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 3-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 83895446 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 3-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(ncn1CC(F)(F)F)CCNC2 |
| InChI | InChI=1S/C9H10F3N3O/c10-9(11,12)4-15-5-14-7-1-2-13-3-6(7)8(15)16/h5,13H,1-4H2 |
| InChIKey | QNZUEPULMKFQSN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |