About 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol
2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol (PubChem CID 83895873) has the molecular formula C8H12BrNO2
and a molecular weight of 234.09 g/mol. Its IUPAC name is 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol |
| PubChem CID | 83895873 |
| Molecular Formula | C8H12BrNO2 |
| Molecular Weight | 234.09 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol |
| SMILES | Cc1oc(Br)c(C)c1C(N)CO |
| InChI | InChI=1S/C8H12BrNO2/c1-4-7(6(10)3-11)5(2)12-8(4)9/h6,11H,3,10H2,1-2H3 |
| InChIKey | SWJXSVDRLMZCLD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.09 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol?
The IUPAC name of 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol (CID 83895873) is 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol.
What is the SMILES notation for 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol?
The canonical SMILES for 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol is Cc1oc(Br)c(C)c1C(N)CO.
What is the InChIKey of 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol?
The InChIKey is SWJXSVDRLMZCLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrNO2/c1-4-7(6(10)3-11)5(2)12-8(4)9/h6,11H,3,10H2,1-2H3.
What are the key properties of 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol?
2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol has a molecular weight of 234.09 g/mol, XLogP of 1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(5-bromo-2,4-dimethylfuran-3-yl)ethanol is sourced from PubChem (CID 83895873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).