About 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid
2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid (PubChem CID 83896390) has the molecular formula C10H9N3O4
and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid |
| PubChem CID | 83896390 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid |
| SMILES | Cc1nc([N+](=O)[O-])c2cccc(CC(=O)O)n12 |
| InChI | InChI=1S/C10H9N3O4/c1-6-11-10(13(16)17)8-4-2-3-7(12(6)8)5-9(14)15/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | QTPVBHBGIOTONT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid?
The IUPAC name of 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid (CID 83896390) is 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid.
What is the SMILES notation for 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid?
The canonical SMILES for 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid is Cc1nc([N+](=O)[O-])c2cccc(CC(=O)O)n12.
What is the InChIKey of 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid?
The InChIKey is QTPVBHBGIOTONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O4/c1-6-11-10(13(16)17)8-4-2-3-7(12(6)8)5-9(14)15/h2-4H,5H2,1H3,(H,14,15).
What are the key properties of 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid?
2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid has a molecular weight of 235.20 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1-nitroimidazo[1,5-a]pyridin-5-yl)acetic acid is sourced from PubChem (CID 83896390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).