About ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate
ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate (PubChem CID 838970) has the molecular formula C20H27NO3
and a molecular weight of 329.44 g/mol. Its IUPAC name is ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate |
| PubChem CID | 838970 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate |
| SMILES | CCOC(=O)[C@@H](C#N)[C@]1(c2ccc(C)cc2)CCO[C@@](C)(CC)C1 |
| InChI | InChI=1S/C20H27NO3/c1-5-19(4)14-20(11-12-24-19,16-9-7-15(3)8-10-16)17(13-21)18(22)23-6-2/h7-10,17H,5-6,11-12,14H2,1-4H3/t17-,19+,20-/m1/s1 |
| InChIKey | LQFZXZWNYQBDOY-YZGWKJHDSA-N |
| XLogP | 3.91 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate?
The IUPAC name of ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate (CID 838970) is ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate.
What is the SMILES notation for ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate?
The canonical SMILES for ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate is CCOC(=O)[C@@H](C#N)[C@]1(c2ccc(C)cc2)CCO[C@@](C)(CC)C1.
What is the InChIKey of ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate?
The InChIKey is LQFZXZWNYQBDOY-YZGWKJHDSA-N. The full InChI is InChI=1S/C20H27NO3/c1-5-19(4)14-20(11-12-24-19,16-9-7-15(3)8-10-16)17(13-21)18(22)23-6-2/h7-10,17H,5-6,11-12,14H2,1-4H3/t17-,19+,20-/m1/s1.
What are the key properties of ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate?
ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate has a molecular weight of 329.44 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-cyano-2-[(2S,4S)-2-ethyl-2-methyl-4-(4-methylphenyl)oxan-4-yl]acetate is sourced from PubChem (CID 838970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).