About 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine
1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine (PubChem CID 83898792) has the molecular formula C9H10BrN3
and a molecular weight of 240.10 g/mol. Its IUPAC name is 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine.
Molecular Properties
| Compound Name | 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine |
| PubChem CID | 83898792 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine |
| SMILES | CNc1cccc2c(Br)nc(C)n12 |
| InChI | InChI=1S/C9H10BrN3/c1-6-12-9(10)7-4-3-5-8(11-2)13(6)7/h3-5,11H,1-2H3 |
| InChIKey | DXIAXDGTBWVCHA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine?
The IUPAC name of 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine (CID 83898792) is 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine.
What is the SMILES notation for 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine?
The canonical SMILES for 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine is CNc1cccc2c(Br)nc(C)n12.
What is the InChIKey of 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine?
The InChIKey is DXIAXDGTBWVCHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN3/c1-6-12-9(10)7-4-3-5-8(11-2)13(6)7/h3-5,11H,1-2H3.
What are the key properties of 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine?
1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine has a molecular weight of 240.10 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N,3-dimethylimidazo[1,5-a]pyridin-5-amine is sourced from PubChem (CID 83898792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).