C11H17ClN2S — CID 83899939
1-[(4-chloro-5-methylthiophen-2-yl)methyl]-1,4-diazepane (PubChem CID 83899939) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is 1-[(4-chloro-5-methylthiophen-2-yl)methyl]-1,4-diazepane.
| Compound Name | 1-[(4-chloro-5-methylthiophen-2-yl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 83899939 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-[(4-chloro-5-methylthiophen-2-yl)methyl]-1,4-diazepane |
| SMILES | Cc1sc(CN2CCCNCC2)cc1Cl |
| InChI | InChI=1S/C11H17ClN2S/c1-9-11(12)7-10(15-9)8-14-5-2-3-13-4-6-14/h7,13H,2-6,8H2,1H3 |
| InChIKey | OWNSHBYJPAATOL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |