About 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine
1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine (PubChem CID 83900538) has the molecular formula C10H10BrN3
and a molecular weight of 252.12 g/mol. Its IUPAC name is 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine.
Molecular Properties
| Compound Name | 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine |
| PubChem CID | 83900538 |
| Molecular Formula | C10H10BrN3 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine |
| SMILES | Brc1ncn2cccc(NC3CC3)c12 |
| InChI | InChI=1S/C10H10BrN3/c11-10-9-8(13-7-3-4-7)2-1-5-14(9)6-12-10/h1-2,5-7,13H,3-4H2 |
| InChIKey | VMNXFGITBAXMMH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine?
The IUPAC name of 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine (CID 83900538) is 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine.
What is the SMILES notation for 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine?
The canonical SMILES for 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine is Brc1ncn2cccc(NC3CC3)c12.
What is the InChIKey of 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine?
The InChIKey is VMNXFGITBAXMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3/c11-10-9-8(13-7-3-4-7)2-1-5-14(9)6-12-10/h1-2,5-7,13H,3-4H2.
What are the key properties of 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine?
1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine has a molecular weight of 252.12 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-cyclopropylimidazo[1,5-a]pyridin-8-amine is sourced from PubChem (CID 83900538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).