About 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one
7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 83903186) has the molecular formula C8H4BrN3O3
and a molecular weight of 270.04 g/mol. Its IUPAC name is 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 83903186 |
| Molecular Formula | C8H4BrN3O3 |
| Molecular Weight | 270.04 g/mol |
| Exact Mass | 268.94 |
| IUPAC Name | 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C8H4BrN3O3/c9-5-1-2-7-10-3-6(12(14)15)8(13)11(7)4-5/h1-4H |
| InChIKey | WKWZBMZYSYIXQX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.04 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one (CID 83903186) is 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one is O=c1c([N+](=O)[O-])cnc2ccc(Br)cn12.
What is the InChIKey of 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one?
The InChIKey is WKWZBMZYSYIXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrN3O3/c9-5-1-2-7-10-3-6(12(14)15)8(13)11(7)4-5/h1-4H.
What are the key properties of 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one?
7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one has a molecular weight of 270.04 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-nitropyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 83903186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).