About 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine
2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine (PubChem CID 83903664) has the molecular formula C10H11BrN2S
and a molecular weight of 271.18 g/mol. Its IUPAC name is 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine |
| PubChem CID | 83903664 |
| Molecular Formula | C10H11BrN2S |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine |
| SMILES | CC(CN)c1cc(Br)cc2ncsc12 |
| InChI | InChI=1S/C10H11BrN2S/c1-6(4-12)8-2-7(11)3-9-10(8)14-5-13-9/h2-3,5-6H,4,12H2,1H3 |
| InChIKey | YQSRYKNJCJNSPV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine?
The IUPAC name of 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine (CID 83903664) is 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine.
What is the SMILES notation for 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine?
The canonical SMILES for 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine is CC(CN)c1cc(Br)cc2ncsc12.
What is the InChIKey of 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine?
The InChIKey is YQSRYKNJCJNSPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2S/c1-6(4-12)8-2-7(11)3-9-10(8)14-5-13-9/h2-3,5-6H,4,12H2,1H3.
What are the key properties of 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine?
2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine has a molecular weight of 271.18 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1,3-benzothiazol-7-yl)propan-1-amine is sourced from PubChem (CID 83903664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).