C11H14BrNO2 — CID 83903752
2-(6-bromo-4H-1,3-benzodioxin-8-yl)-N-methylethanamine (PubChem CID 83903752) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-N-methylethanamine.
| Compound Name | 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 83903752 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-N-methylethanamine |
| SMILES | CNCCc1cc(Br)cc2c1OCOC2 |
| InChI | InChI=1S/C11H14BrNO2/c1-13-3-2-8-4-10(12)5-9-6-14-7-15-11(8)9/h4-5,13H,2-3,6-7H2,1H3 |
| InChIKey | ZCDHYQWRZCINRW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |