C9H13BrN4O — CID 83904063
(5-bromo-4-methyl-1H-pyrazol-3-yl)-piperazin-1-ylmethanone (PubChem CID 83904063) has the molecular formula C9H13BrN4O and a molecular weight of 273.13 g/mol. Its IUPAC name is (5-bromo-4-methyl-1H-pyrazol-3-yl)-piperazin-1-ylmethanone.
| Compound Name | (5-bromo-4-methyl-1H-pyrazol-3-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 83904063 |
| Molecular Formula | C9H13BrN4O |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | (5-bromo-4-methyl-1H-pyrazol-3-yl)-piperazin-1-ylmethanone |
| SMILES | Cc1c(C(=O)N2CCNCC2)n[nH]c1Br |
| InChI | InChI=1S/C9H13BrN4O/c1-6-7(12-13-8(6)10)9(15)14-4-2-11-3-5-14/h11H,2-5H2,1H3,(H,12,13) |
| InChIKey | HFIQIMJDLIGIQV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |