2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid

C8H9NO2 — CID 83905034

IUPAC2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid
SMILESO=C(O)C1CCc2c[nH]cc21
InChIInChI=1S/C8H9NO2/c10-8(11)6-2-1-5-3-9-4-7(5)6/h3-4,6,9H,1-2H2,(H,10,11)
InChIKeyMEPPXUIRDYJXST-UHFFFAOYSA-N
MW151.16 g/mol
LogP1.13
Rot. Bonds1

About 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid

2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid (PubChem CID 83905034) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid.

Molecular Properties

Compound Name2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid
PubChem CID83905034
Molecular FormulaC8H9NO2
Molecular Weight151.16 g/mol
Exact Mass151.06
IUPAC Name2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid
SMILESO=C(O)C1CCc2c[nH]cc21
InChIInChI=1S/C8H9NO2/c10-8(11)6-2-1-5-3-9-4-7(5)6/h3-4,6,9H,1-2H2,(H,10,11)
InChIKeyMEPPXUIRDYJXST-UHFFFAOYSA-N
XLogP1.13
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.16
LogP ≤ 51.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid?
The IUPAC name of 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid (CID 83905034) is 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid.
What is the SMILES notation for 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid?
The canonical SMILES for 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid is O=C(O)C1CCc2c[nH]cc21.
What is the InChIKey of 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid?
The InChIKey is MEPPXUIRDYJXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c10-8(11)6-2-1-5-3-9-4-7(5)6/h3-4,6,9H,1-2H2,(H,10,11).
What are the key properties of 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid?
2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid has a molecular weight of 151.16 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-4-carboxylic acid is sourced from PubChem (CID 83905034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).