About (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol
(4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol (PubChem CID 83905073) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol.
Molecular Properties
| Compound Name | (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol |
| PubChem CID | 83905073 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol |
| SMILES | NC1(CO)CCc2c[nH]cc21 |
| InChI | InChI=1S/C8H12N2O/c9-8(5-11)2-1-6-3-10-4-7(6)8/h3-4,10-11H,1-2,5,9H2 |
| InChIKey | CFIKFCZHZIHCBJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol?
The IUPAC name of (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol (CID 83905073) is (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol.
What is the SMILES notation for (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol?
The canonical SMILES for (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol is NC1(CO)CCc2c[nH]cc21.
What is the InChIKey of (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol?
The InChIKey is CFIKFCZHZIHCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-8(5-11)2-1-6-3-10-4-7(6)8/h3-4,10-11H,1-2,5,9H2.
What are the key properties of (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol?
(4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol has a molecular weight of 152.20 g/mol, XLogP of 0.11, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-5,6-dihydro-2H-cyclopenta[c]pyrrol-4-yl)methanol is sourced from PubChem (CID 83905073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).