2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid

C9H11NO2 — CID 83905455

IUPAC2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid
SMILESCn1cc2c(c1)C(C(=O)O)CC2
InChIInChI=1S/C9H11NO2/c1-10-4-6-2-3-7(9(11)12)8(6)5-10/h4-5,7H,2-3H2,1H3,(H,11,12)
InChIKeyVMPYMHAFBPESEC-UHFFFAOYSA-N
MW165.19 g/mol
LogP1.14
Rot. Bonds1

About 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid

2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid (PubChem CID 83905455) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid.

Molecular Properties

Compound Name2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid
PubChem CID83905455
Molecular FormulaC9H11NO2
Molecular Weight165.19 g/mol
Exact Mass165.08
IUPAC Name2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid
SMILESCn1cc2c(c1)C(C(=O)O)CC2
InChIInChI=1S/C9H11NO2/c1-10-4-6-2-3-7(9(11)12)8(6)5-10/h4-5,7H,2-3H2,1H3,(H,11,12)
InChIKeyVMPYMHAFBPESEC-UHFFFAOYSA-N
XLogP1.14
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.19
LogP ≤ 51.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid?
The IUPAC name of 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid (CID 83905455) is 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid.
What is the SMILES notation for 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid?
The canonical SMILES for 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid is Cn1cc2c(c1)C(C(=O)O)CC2.
What is the InChIKey of 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid?
The InChIKey is VMPYMHAFBPESEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-10-4-6-2-3-7(9(11)12)8(6)5-10/h4-5,7H,2-3H2,1H3,(H,11,12).
What are the key properties of 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid?
2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid has a molecular weight of 165.19 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-4-carboxylic acid is sourced from PubChem (CID 83905455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).