About N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine
N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine (PubChem CID 83905480) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine.
Analyze N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine?
The IUPAC name of N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine (CID 83905480) is N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine.
What is the SMILES notation for N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine?
The canonical SMILES for N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine is CNC1CCCc2cc(C)oc21.
What is the InChIKey of N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine?
The InChIKey is OUDNGZPCXWGSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-7-6-8-4-3-5-9(11-2)10(8)12-7/h6,9,11H,3-5H2,1-2H3.
What are the key properties of N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine?
N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine has a molecular weight of 165.24 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-4,5,6,7-tetrahydro-1-benzofuran-7-amine is sourced from PubChem (CID 83905480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).