About 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol
7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol (PubChem CID 83905664) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol.
Molecular Properties
| Compound Name | 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol |
| PubChem CID | 83905664 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol |
| SMILES | NCC1(O)CCCc2cnoc21 |
| InChI | InChI=1S/C8H12N2O2/c9-5-8(11)3-1-2-6-4-10-12-7(6)8/h4,11H,1-3,5,9H2 |
| InChIKey | FMRAWJATXHLVDB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol?
The IUPAC name of 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol (CID 83905664) is 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol.
What is the SMILES notation for 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol?
The canonical SMILES for 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol is NCC1(O)CCCc2cnoc21.
What is the InChIKey of 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol?
The InChIKey is FMRAWJATXHLVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c9-5-8(11)3-1-2-6-4-10-12-7(6)8/h4,11H,1-3,5,9H2.
What are the key properties of 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol?
7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol has a molecular weight of 168.20 g/mol, XLogP of 0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(aminomethyl)-5,6-dihydro-4H-1,2-benzoxazol-7-ol is sourced from PubChem (CID 83905664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).