About spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine]
spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine] (PubChem CID 83906212) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine].
Molecular Properties
| Compound Name | spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine] |
| PubChem CID | 83906212 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine] |
| SMILES | c1cc2c(o1)C1(CCC2)CCNC1 |
| InChI | InChI=1S/C11H15NO/c1-2-9-3-7-13-10(9)11(4-1)5-6-12-8-11/h3,7,12H,1-2,4-6,8H2 |
| InChIKey | QZTSZJGACWQKEY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine]?
The IUPAC name of spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine] (CID 83906212) is spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine].
What is the SMILES notation for spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine]?
The canonical SMILES for spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine] is c1cc2c(o1)C1(CCC2)CCNC1.
What is the InChIKey of spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine]?
The InChIKey is QZTSZJGACWQKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-2-9-3-7-13-10(9)11(4-1)5-6-12-8-11/h3,7,12H,1-2,4-6,8H2.
What are the key properties of spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine]?
spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine] has a molecular weight of 177.25 g/mol, XLogP of 1.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[5,6-dihydro-4H-1-benzofuran-7,3'-pyrrolidine] is sourced from PubChem (CID 83906212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).