C12H21N — CID 83906411
N-cyclopropyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-amine (PubChem CID 83906411) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N-cyclopropyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-amine.
| Compound Name | N-cyclopropyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 83906411 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-cyclopropyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-amine |
| SMILES | C1CC2CCCC2C(NC2CC2)C1 |
| InChI | InChI=1S/C12H21N/c1-3-9-4-2-6-12(11(9)5-1)13-10-7-8-10/h9-13H,1-8H2 |
| InChIKey | MEZONUKPWURMDV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |