About methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate
methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate (PubChem CID 83906472) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate |
| PubChem CID | 83906472 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate |
| SMILES | COC(=O)C1(N)CCc2[nH]ncc21 |
| InChI | InChI=1S/C8H11N3O2/c1-13-7(12)8(9)3-2-6-5(8)4-10-11-6/h4H,2-3,9H2,1H3,(H,10,11) |
| InChIKey | INUIIYBUWREJJO-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate?
The IUPAC name of methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate (CID 83906472) is methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate.
What is the SMILES notation for methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate?
The canonical SMILES for methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate is COC(=O)C1(N)CCc2[nH]ncc21.
What is the InChIKey of methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate?
The InChIKey is INUIIYBUWREJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-13-7(12)8(9)3-2-6-5(8)4-10-11-6/h4H,2-3,9H2,1H3,(H,10,11).
What are the key properties of methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate?
methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate has a molecular weight of 181.19 g/mol, XLogP of -0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylate is sourced from PubChem (CID 83906472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).