About 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine
1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine (PubChem CID 83906770) has the molecular formula C11H21NO
and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine |
| PubChem CID | 83906770 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine |
| SMILES | C[C@@H]1CC(CC2(N)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C11H21NO/c1-8-5-10(6-9(2)13-8)7-11(12)3-4-11/h8-10H,3-7,12H2,1-2H3/t8-,9+,10? |
| InChIKey | QMHXJLAWHFLCIW-ULKQDVFKSA-N |
| XLogP | 2.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine?
The IUPAC name of 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine (CID 83906770) is 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine?
The canonical SMILES for 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine is C[C@@H]1CC(CC2(N)CC2)C[C@H](C)O1.
What is the InChIKey of 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine?
The InChIKey is QMHXJLAWHFLCIW-ULKQDVFKSA-N. The full InChI is InChI=1S/C11H21NO/c1-8-5-10(6-9(2)13-8)7-11(12)3-4-11/h8-10H,3-7,12H2,1-2H3/t8-,9+,10?.
What are the key properties of 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine?
1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine has a molecular weight of 183.30 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2S,6R)-2,6-dimethyloxan-4-yl]methyl]cyclopropan-1-amine is sourced from PubChem (CID 83906770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).