About 3-(1,2,6-trimethylpiperidin-4-yl)propanal
3-(1,2,6-trimethylpiperidin-4-yl)propanal (PubChem CID 83906805) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 3-(1,2,6-trimethylpiperidin-4-yl)propanal.
Molecular Properties
| Compound Name | 3-(1,2,6-trimethylpiperidin-4-yl)propanal |
| PubChem CID | 83906805 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3-(1,2,6-trimethylpiperidin-4-yl)propanal |
| SMILES | CC1CC(CCC=O)CC(C)N1C |
| InChI | InChI=1S/C11H21NO/c1-9-7-11(5-4-6-13)8-10(2)12(9)3/h6,9-11H,4-5,7-8H2,1-3H3 |
| InChIKey | ZOXCIRUXLNDPFN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2,6-trimethylpiperidin-4-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,6-trimethylpiperidin-4-yl)propanal?
The IUPAC name of 3-(1,2,6-trimethylpiperidin-4-yl)propanal (CID 83906805) is 3-(1,2,6-trimethylpiperidin-4-yl)propanal.
What is the SMILES notation for 3-(1,2,6-trimethylpiperidin-4-yl)propanal?
The canonical SMILES for 3-(1,2,6-trimethylpiperidin-4-yl)propanal is CC1CC(CCC=O)CC(C)N1C.
What is the InChIKey of 3-(1,2,6-trimethylpiperidin-4-yl)propanal?
The InChIKey is ZOXCIRUXLNDPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-9-7-11(5-4-6-13)8-10(2)12(9)3/h6,9-11H,4-5,7-8H2,1-3H3.
What are the key properties of 3-(1,2,6-trimethylpiperidin-4-yl)propanal?
3-(1,2,6-trimethylpiperidin-4-yl)propanal has a molecular weight of 183.29 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,6-trimethylpiperidin-4-yl)propanal is sourced from PubChem (CID 83906805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).