About (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine
(2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine (PubChem CID 83907092) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine |
| PubChem CID | 83907092 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine |
| SMILES | COCCC1(N)C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C10H21NO2/c1-8-6-10(11,4-5-12-3)7-9(2)13-8/h8-9H,4-7,11H2,1-3H3/t8-,9+,10? |
| InChIKey | CWGVRRVLYIJUIM-ULKQDVFKSA-N |
| XLogP | 1.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine?
The IUPAC name of (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine (CID 83907092) is (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine.
What is the SMILES notation for (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine?
The canonical SMILES for (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine is COCCC1(N)C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine?
The InChIKey is CWGVRRVLYIJUIM-ULKQDVFKSA-N. The full InChI is InChI=1S/C10H21NO2/c1-8-6-10(11,4-5-12-3)7-9(2)13-8/h8-9H,4-7,11H2,1-3H3/t8-,9+,10?.
What are the key properties of (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine?
(2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine has a molecular weight of 187.28 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-4-(2-methoxyethyl)-2,6-dimethyloxan-4-amine is sourced from PubChem (CID 83907092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).