C12H16N2 — CID 83907169
N-cyclopropyl-5,6,7,8-tetrahydroisoquinolin-8-amine (PubChem CID 83907169) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-cyclopropyl-5,6,7,8-tetrahydroisoquinolin-8-amine.
| Compound Name | N-cyclopropyl-5,6,7,8-tetrahydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 83907169 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-cyclopropyl-5,6,7,8-tetrahydroisoquinolin-8-amine |
| SMILES | c1cc2c(cn1)C(NC1CC1)CCC2 |
| InChI | InChI=1S/C12H16N2/c1-2-9-6-7-13-8-11(9)12(3-1)14-10-4-5-10/h6-8,10,12,14H,1-5H2 |
| InChIKey | RUVZLNOPVOEKFE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |