About 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (PubChem CID 83907720) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.
Analyze 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The IUPAC name of 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (CID 83907720) is 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.
What is the SMILES notation for 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The canonical SMILES for 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is Cc1c2c(nn1C)CCCC2C(=O)O.
What is the InChIKey of 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The InChIKey is GHZMKKNMOFJMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-6-9-7(10(13)14)4-3-5-8(9)11-12(6)2/h7H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid has a molecular weight of 194.23 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is sourced from PubChem (CID 83907720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).