About 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid
3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (PubChem CID 83908635) has the molecular formula C10H8N2O3
and a molecular weight of 204.19 g/mol. Its IUPAC name is 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid.
Analyze 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid?
The IUPAC name of 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CID 83908635) is 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid.
What is the SMILES notation for 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid?
The canonical SMILES for 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid is O=C(O)c1ccnc2onc(C3CC3)c12.
What is the InChIKey of 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid?
The InChIKey is CTTRNTIRUDPVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c13-10(14)6-3-4-11-9-7(6)8(12-15-9)5-1-2-5/h3-5H,1-2H2,(H,13,14).
What are the key properties of 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid?
3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid has a molecular weight of 204.19 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid is sourced from PubChem (CID 83908635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).