About 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid
4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid (PubChem CID 83909322) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid.
Analyze 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid?
The IUPAC name of 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid (CID 83909322) is 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid.
What is the SMILES notation for 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid?
The canonical SMILES for 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid is CCc1n[nH]c2c1C(N)(C(=O)O)CCC2.
What is the InChIKey of 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid?
The InChIKey is DJIPPBMEVIKKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-2-6-8-7(13-12-6)4-3-5-10(8,11)9(14)15/h2-5,11H2,1H3,(H,12,13)(H,14,15).
What are the key properties of 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid?
4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid has a molecular weight of 209.25 g/mol, XLogP of 0.55, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-ethyl-1,5,6,7-tetrahydroindazole-4-carboxylic acid is sourced from PubChem (CID 83909322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).